C9H16N2O4 — CID 80750294
(2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 80750294) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80750294 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | NC1(C(=O)N[C@H](CO)C(=O)O)CCCC1 |
| InChI | InChI=1S/C9H16N2O4/c10-9(3-1-2-4-9)8(15)11-6(5-12)7(13)14/h6,12H,1-5,10H2,(H,11,15)(H,13,14)/t6-/m1/s1 |
| InChIKey | UPXBGNGXCWTGJY-ZCFIWIBFSA-N |
| XLogP | -1.18 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |