C12H14FNO3S — CID 80758599
5-fluoro-3-hydroxy-6-(3-methoxypropylsulfanyl)-1,3-dihydroindol-2-one (PubChem CID 80758599) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-6-(3-methoxypropylsulfanyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-6-(3-methoxypropylsulfanyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80758599 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 5-fluoro-3-hydroxy-6-(3-methoxypropylsulfanyl)-1,3-dihydroindol-2-one |
| SMILES | COCCCSc1cc2c(cc1F)C(O)C(=O)N2 |
| InChI | InChI=1S/C12H14FNO3S/c1-17-3-2-4-18-10-6-9-7(5-8(10)13)11(15)12(16)14-9/h5-6,11,15H,2-4H2,1H3,(H,14,16) |
| InChIKey | IHIOOBMUPDFVEL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|