C11H9Cl3N4 — CID 80759461
6-methyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 80759461) has the molecular formula C11H9Cl3N4 and a molecular weight of 303.58 g/mol. Its IUPAC name is 6-methyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80759461 |
| Molecular Formula | C11H9Cl3N4 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 6-methyl-4-N-(2,4,5-trichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2cc(Cl)c(Cl)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C11H9Cl3N4/c1-5-2-10(18-11(15)16-5)17-9-4-7(13)6(12)3-8(9)14/h2-4H,1H3,(H3,15,16,17,18) |
| InChIKey | WPUNTOXSVPSAJR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|