C13H15IN4 — CID 80763667
4-N-(3-iodophenyl)-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80763667) has the molecular formula C13H15IN4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 4-N-(3-iodophenyl)-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-iodophenyl)-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80763667 |
| Molecular Formula | C13H15IN4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-N-(3-iodophenyl)-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(Nc2cccc(I)c2)ncn1 |
| InChI | InChI=1S/C13H15IN4/c1-2-6-15-12-8-13(17-9-16-12)18-11-5-3-4-10(14)7-11/h3-5,7-9H,2,6H2,1H3,(H2,15,16,17,18) |
| InChIKey | UXTPNSSJXXQMSB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|