C14H17IN4 — CID 80762837
4-N-(3-iodophenyl)-6-methyl-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80762837) has the molecular formula C14H17IN4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-N-(3-iodophenyl)-6-methyl-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-iodophenyl)-6-methyl-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80762837 |
| Molecular Formula | C14H17IN4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-N-(3-iodophenyl)-6-methyl-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(C)cc(Nc2cccc(I)c2)n1 |
| InChI | InChI=1S/C14H17IN4/c1-3-7-16-14-17-10(2)8-13(19-14)18-12-6-4-5-11(15)9-12/h4-6,8-9H,3,7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | GRFOWSCLKZUYBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|