C16H23N5 — CID 80774654
8-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80774654) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 8-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80774654 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CNc1cn2ccnc2c(N2CCC3CCCCC3C2)n1 |
| InChI | InChI=1S/C16H23N5/c1-17-14-11-21-9-7-18-15(21)16(19-14)20-8-6-12-4-2-3-5-13(12)10-20/h7,9,11-13,17H,2-6,8,10H2,1H3 |
| InChIKey | AQBOTZOSCYDWER-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |