About N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine
N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80796047) has the molecular formula C12H17N5S
and a molecular weight of 263.37 g/mol. Its IUPAC name is N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 80796047 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CNc1cn2ccnc2c(N2CCCSCC2)n1 |
| InChI | InChI=1S/C12H17N5S/c1-13-10-9-17-5-3-14-11(17)12(15-10)16-4-2-7-18-8-6-16/h3,5,9,13H,2,4,6-8H2,1H3 |
| InChIKey | ZSJNYPZAGMPKGX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine (CID 80796047) is N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine is CNc1cn2ccnc2c(N2CCCSCC2)n1.
What is the InChIKey of N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is ZSJNYPZAGMPKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5S/c1-13-10-9-17-5-3-14-11(17)12(15-10)16-4-2-7-18-8-6-16/h3,5,9,13H,2,4,6-8H2,1H3.
What are the key properties of N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine?
N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 263.37 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-8-(1,4-thiazepan-4-yl)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 80796047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).