C12H17N7O — CID 80927836
1-[4-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanone (PubChem CID 80927836) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-[4-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 80927836 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[4-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2nc(NN)cn3ccnc23)CC1 |
| InChI | InChI=1S/C12H17N7O/c1-9(20)17-4-6-18(7-5-17)12-11-14-2-3-19(11)8-10(15-12)16-13/h2-3,8,16H,4-7,13H2,1H3 |
| InChIKey | KYPNCHBELUSDIA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|