C11H13N7 — CID 80901889
[8-(2-ethylimidazol-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80901889) has the molecular formula C11H13N7 and a molecular weight of 243.27 g/mol. Its IUPAC name is [8-(2-ethylimidazol-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(2-ethylimidazol-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80901889 |
| Molecular Formula | C11H13N7 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | [8-(2-ethylimidazol-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | CCc1nccn1-c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C11H13N7/c1-2-9-13-4-6-18(9)11-10-14-3-5-17(10)7-8(15-11)16-12/h3-7,16H,2,12H2,1H3 |
| InChIKey | DVLLWFRSVIJDSS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|