C15H24N6 — CID 80903209
[8-(4-tert-butylpiperidin-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80903209) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is [8-(4-tert-butylpiperidin-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(4-tert-butylpiperidin-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80903209 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [8-(4-tert-butylpiperidin-1-yl)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | CC(C)(C)C1CCN(c2nc(NN)cn3ccnc23)CC1 |
| InChI | InChI=1S/C15H24N6/c1-15(2,3)11-4-7-20(8-5-11)14-13-17-6-9-21(13)10-12(18-14)19-16/h6,9-11,19H,4-5,7-8,16H2,1-3H3 |
| InChIKey | VDMVMVDRDXVFKE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|