C12H22N4 — CID 80782465
4-N-butan-2-yl-4-N,6-N-diethylpyrimidine-4,6-diamine (PubChem CID 80782465) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-N-butan-2-yl-4-N,6-N-diethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butan-2-yl-4-N,6-N-diethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80782465 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-N-butan-2-yl-4-N,6-N-diethylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(N(CC)C(C)CC)ncn1 |
| InChI | InChI=1S/C12H22N4/c1-5-10(4)16(7-3)12-8-11(13-6-2)14-9-15-12/h8-10H,5-7H2,1-4H3,(H,13,14,15) |
| InChIKey | IGGFRDAILNCNIS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |