C10H12N6 — CID 80753559
2-[cyanomethyl-[6-(ethylamino)pyrimidin-4-yl]amino]acetonitrile (PubChem CID 80753559) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-(ethylamino)pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-(ethylamino)pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 80753559 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[cyanomethyl-[6-(ethylamino)pyrimidin-4-yl]amino]acetonitrile |
| SMILES | CCNc1cc(N(CC#N)CC#N)ncn1 |
| InChI | InChI=1S/C10H12N6/c1-2-13-9-7-10(15-8-14-9)16(5-3-11)6-4-12/h7-8H,2,5-6H2,1H3,(H,13,14,15) |
| InChIKey | ZXBDLTYFOHFIEP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|