C11H17N5 — CID 80811502
3-[[6-(ethylamino)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile (PubChem CID 80811502) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-[[6-(ethylamino)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[[6-(ethylamino)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 80811502 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-[[6-(ethylamino)pyrimidin-4-yl]-methylamino]-2-methylpropanenitrile |
| SMILES | CCNc1cc(N(C)CC(C)C#N)ncn1 |
| InChI | InChI=1S/C11H17N5/c1-4-13-10-5-11(15-8-14-10)16(3)7-9(2)6-12/h5,8-9H,4,7H2,1-3H3,(H,13,14,15) |
| InChIKey | IDEJQQSGARVBES-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |