C11H16N8S — CID 80783628
2-N,4-N-dimethyl-4-N-(thiolan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80783628) has the molecular formula C11H16N8S and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80783628 |
| Molecular Formula | C11H16N8S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-(thiolan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C2CCSC2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H16N8S/c1-12-9-15-10(18(2)8-3-4-20-5-8)17-11(16-9)19-7-13-6-14-19/h6-8H,3-5H2,1-2H3,(H,12,15,16,17) |
| InChIKey | ZZAYIHVZNAEOIM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |