C9H14FN5O — CID 80800082
2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-ethylpropanamide (PubChem CID 80800082) has the molecular formula C9H14FN5O and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-ethylpropanamide.
| Compound Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 80800082 |
| Molecular Formula | C9H14FN5O |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Nc1nc(N)ncc1F |
| InChI | InChI=1S/C9H14FN5O/c1-3-12-8(16)5(2)14-7-6(10)4-13-9(11)15-7/h4-5H,3H2,1-2H3,(H,12,16)(H3,11,13,14,15) |
| InChIKey | DMRRMTLUFIXDBO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |