C10H16N4OS — CID 80805027
N,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine (PubChem CID 80805027) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is N,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine.
| Compound Name | N,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80805027 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-amine |
| SMILES | CNc1cc(N2CCS(=O)CC2)nc(C)n1 |
| InChI | InChI=1S/C10H16N4OS/c1-8-12-9(11-2)7-10(13-8)14-3-5-16(15)6-4-14/h7H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | SBZZXNJLGOYWDD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |