C11H20N4 — CID 80817416
2-N-hexan-3-yl-6-N-methylpyrazine-2,6-diamine (PubChem CID 80817416) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-N-hexan-3-yl-6-N-methylpyrazine-2,6-diamine.
| Compound Name | 2-N-hexan-3-yl-6-N-methylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80817416 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-N-hexan-3-yl-6-N-methylpyrazine-2,6-diamine |
| SMILES | CCCC(CC)Nc1cncc(NC)n1 |
| InChI | InChI=1S/C11H20N4/c1-4-6-9(5-2)14-11-8-13-7-10(12-3)15-11/h7-9H,4-6H2,1-3H3,(H2,12,14,15) |
| InChIKey | ZCQAHFNCHPBAHG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |