C13H24N6 — CID 80820992
2-N-(cyclopropylmethyl)-4-N,4-N,6-N-trimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80820992) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-N-(cyclopropylmethyl)-4-N,4-N,6-N-trimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(cyclopropylmethyl)-4-N,4-N,6-N-trimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80820992 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-N-(cyclopropylmethyl)-4-N,4-N,6-N-trimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N(C)C)nc(N(CC2CC2)C(C)C)n1 |
| InChI | InChI=1S/C13H24N6/c1-9(2)19(8-10-6-7-10)13-16-11(14-3)15-12(17-13)18(4)5/h9-10H,6-8H2,1-5H3,(H,14,15,16,17) |
| InChIKey | ZPDPACVSUMKUJY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |