C10H18N6 — CID 80826128
2-N,2-N,6-N-trimethyl-4-N-(2-methylcyclopropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80826128) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(2-methylcyclopropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(2-methylcyclopropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80826128 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(2-methylcyclopropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NC2CC2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H18N6/c1-6-5-7(6)12-9-13-8(11-2)14-10(15-9)16(3)4/h6-7H,5H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | NIXTZCZSRYZQFT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |