C14H27N7 — CID 80783238
2-N,2-N,6-N-trimethyl-4-N-(1-propylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80783238) has the molecular formula C14H27N7 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(1-propylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(1-propylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80783238 |
| Molecular Formula | C14H27N7 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(1-propylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCN1CCC(Nc2nc(NC)nc(N(C)C)n2)CC1 |
| InChI | InChI=1S/C14H27N7/c1-5-8-21-9-6-11(7-10-21)16-13-17-12(15-2)18-14(19-13)20(3)4/h11H,5-10H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | IYASAHYSQVJIPV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |