C13H24N6 — CID 80849007
2-N,2-N,6-N-trimethyl-4-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80849007) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80849007 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NC2C(C)(C)C2(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H24N6/c1-12(2)8(13(12,3)4)15-10-16-9(14-5)17-11(18-10)19(6)7/h8H,1-7H3,(H2,14,15,16,17,18) |
| InChIKey | UXMNEUHDFRJOJT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |