C11H12N8O2 — CID 80831736
3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 80831736) has the molecular formula C11H12N8O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 80831736 |
| Molecular Formula | C11H12N8O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2nc(N)nc(-n3ccnc3)n2)C1=O |
| InChI | InChI=1S/C11H12N8O2/c1-18-7(20)4-6(8(18)21)14-10-15-9(12)16-11(17-10)19-3-2-13-5-19/h2-3,5-6H,4H2,1H3,(H3,12,14,15,16,17) |
| InChIKey | IURNFGISHRPNSR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|