C15H26N6 — CID 80836332
6-piperidin-1-yl-2-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80836332) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is 6-piperidin-1-yl-2-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-piperidin-1-yl-2-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80836332 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 6-piperidin-1-yl-2-N-(2,2,3,3-tetramethylcyclopropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)C(Nc2nc(N)nc(N3CCCCC3)n2)C1(C)C |
| InChI | InChI=1S/C15H26N6/c1-14(2)10(15(14,3)4)17-12-18-11(16)19-13(20-12)21-8-6-5-7-9-21/h10H,5-9H2,1-4H3,(H3,16,17,18,19,20) |
| InChIKey | WJYDXTASBWCOIG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |