C17H26N4 — CID 80838890
4-N-(2,2-dimethylheptyl)quinazoline-2,4-diamine (PubChem CID 80838890) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-N-(2,2-dimethylheptyl)quinazoline-2,4-diamine.
| Compound Name | 4-N-(2,2-dimethylheptyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80838890 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 4-N-(2,2-dimethylheptyl)quinazoline-2,4-diamine |
| SMILES | CCCCCC(C)(C)CNc1nc(N)nc2ccccc12 |
| InChI | InChI=1S/C17H26N4/c1-4-5-8-11-17(2,3)12-19-15-13-9-6-7-10-14(13)20-16(18)21-15/h6-7,9-10H,4-5,8,11-12H2,1-3H3,(H3,18,19,20,21) |
| InChIKey | TULLDUSKTQVKJS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|