C13H10N8 — CID 80841169
4-(benzimidazol-1-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80841169) has the molecular formula C13H10N8 and a molecular weight of 278.28 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(benzimidazol-1-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80841169 |
| Molecular Formula | C13H10N8 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-(benzimidazol-1-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-n2cccn2)nc(-n2cnc3ccccc32)n1 |
| InChI | InChI=1S/C13H10N8/c14-11-17-12(19-13(18-11)21-7-3-6-16-21)20-8-15-9-4-1-2-5-10(9)20/h1-8H,(H2,14,17,18,19) |
| InChIKey | IVIBTSCISVUBEZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |