C12H22N6O — CID 80845884
2-N,4-N,4-N-trimethyl-2-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80845884) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-2-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-2-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80845884 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-2-N-(oxan-4-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(N(C)CC2CCOCC2)n1 |
| InChI | InChI=1S/C12H22N6O/c1-17(2)11-14-10(13)15-12(16-11)18(3)8-9-4-6-19-7-5-9/h9H,4-8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | ULMGGZVXPWJUJZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |