C12H14F2N6 — CID 80845995
4-N-[(2,5-difluorophenyl)methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80845995) has the molecular formula C12H14F2N6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-N-[(2,5-difluorophenyl)methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(2,5-difluorophenyl)methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80845995 |
| Molecular Formula | C12H14F2N6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-N-[(2,5-difluorophenyl)methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(NCc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C12H14F2N6/c1-20(2)12-18-10(15)17-11(19-12)16-6-7-5-8(13)3-4-9(7)14/h3-5H,6H2,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | JBDBEJOWZSIKOU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |