C13H19F3N4 — CID 80847527
N-ethyl-2-methyl-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine (PubChem CID 80847527) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is N-ethyl-2-methyl-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine.
| Compound Name | N-ethyl-2-methyl-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80847527 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-ethyl-2-methyl-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine |
| SMILES | CCNc1cc(N2CCC(C(F)(F)F)CC2)nc(C)n1 |
| InChI | InChI=1S/C13H19F3N4/c1-3-17-11-8-12(19-9(2)18-11)20-6-4-10(5-7-20)13(14,15)16/h8,10H,3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | AHUVGSNFLLNQSR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |