C11H15ClN6O2 — CID 80850816
4-[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]-3-methylpiperazine-2,6-dione (PubChem CID 80850816) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80850816 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]-3-methylpiperazine-2,6-dione |
| SMILES | CCCNc1nc(Cl)nc(N2CC(=O)NC(=O)C2C)n1 |
| InChI | InChI=1S/C11H15ClN6O2/c1-3-4-13-10-15-9(12)16-11(17-10)18-5-7(19)14-8(20)6(18)2/h6H,3-5H2,1-2H3,(H,14,19,20)(H,13,15,16,17) |
| InChIKey | RPGYDBKNCDEWRC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|