C12H15ClN6O2 — CID 66075655
4-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione (PubChem CID 66075655) has the molecular formula C12H15ClN6O2 and a molecular weight of 310.75 g/mol. Its IUPAC name is 4-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075655 |
| Molecular Formula | C12H15ClN6O2 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1nc(Cl)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C12H15ClN6O2/c1-7-9(21)14-8(20)6-19(7)12-16-10(13)15-11(17-12)18-4-2-3-5-18/h7H,2-6H2,1H3,(H,14,20,21) |
| InChIKey | PINHXLDAJSGFQY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|