C11H21N5O — CID 80850995
1-[(2,6-diaminopyrimidin-4-yl)amino]-2,4-dimethylpentan-2-ol (PubChem CID 80850995) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[(2,6-diaminopyrimidin-4-yl)amino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[(2,6-diaminopyrimidin-4-yl)amino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 80850995 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-[(2,6-diaminopyrimidin-4-yl)amino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C11H21N5O/c1-7(2)5-11(3,17)6-14-9-4-8(12)15-10(13)16-9/h4,7,17H,5-6H2,1-3H3,(H5,12,13,14,15,16) |
| InChIKey | OLSIAAWCTVTPLP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |