C13H18ClN3O — CID 83076843
2-chloro-6-[(2-hydroxy-2,4-dimethylpentyl)amino]pyridine-4-carbonitrile (PubChem CID 83076843) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-chloro-6-[(2-hydroxy-2,4-dimethylpentyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(2-hydroxy-2,4-dimethylpentyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83076843 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-chloro-6-[(2-hydroxy-2,4-dimethylpentyl)amino]pyridine-4-carbonitrile |
| SMILES | CC(C)CC(C)(O)CNc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O/c1-9(2)6-13(3,18)8-16-12-5-10(7-15)4-11(14)17-12/h4-5,9,18H,6,8H2,1-3H3,(H,16,17) |
| InChIKey | MKKKEAPEASEXHO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|