C12H16FN5O2 — CID 80851307
4-[2-(ethylamino)-5-fluoropyrimidin-4-yl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 80851307) has the molecular formula C12H16FN5O2 and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-[2-(ethylamino)-5-fluoropyrimidin-4-yl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(ethylamino)-5-fluoropyrimidin-4-yl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80851307 |
| Molecular Formula | C12H16FN5O2 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[2-(ethylamino)-5-fluoropyrimidin-4-yl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CCNc1ncc(F)c(N2CC(=O)NC(=O)C2(C)C)n1 |
| InChI | InChI=1S/C12H16FN5O2/c1-4-14-11-15-5-7(13)9(17-11)18-6-8(19)16-10(20)12(18,2)3/h5H,4,6H2,1-3H3,(H,14,15,17)(H,16,19,20) |
| InChIKey | QUROJHLCSSJVNH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|