C10H13IN6O — CID 80868737
4-ethoxy-N-ethyl-6-(4-iodopyrazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80868737) has the molecular formula C10H13IN6O and a molecular weight of 360.16 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-6-(4-iodopyrazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-N-ethyl-6-(4-iodopyrazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80868737 |
| Molecular Formula | C10H13IN6O |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4-ethoxy-N-ethyl-6-(4-iodopyrazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(-n2cc(I)cn2)n1 |
| InChI | InChI=1S/C10H13IN6O/c1-3-12-8-14-9(16-10(15-8)18-4-2)17-6-7(11)5-13-17/h5-6H,3-4H2,1-2H3,(H,12,14,15,16) |
| InChIKey | YQEAZWSZFZSEAO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|