C14H12N4O — CID 80870122
6-naphthalen-2-yloxypyrimidine-2,4-diamine (PubChem CID 80870122) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 6-naphthalen-2-yloxypyrimidine-2,4-diamine.
| Compound Name | 6-naphthalen-2-yloxypyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80870122 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 6-naphthalen-2-yloxypyrimidine-2,4-diamine |
| SMILES | Nc1cc(Oc2ccc3ccccc3c2)nc(N)n1 |
| InChI | InChI=1S/C14H12N4O/c15-12-8-13(18-14(16)17-12)19-11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,(H4,15,16,17,18) |
| InChIKey | QVEJZMYJXBNCKW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |