C15H17N5S — CID 80882835
4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-N-propylpyrimidin-2-amine (PubChem CID 80882835) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-N-propylpyrimidin-2-amine.
| Compound Name | 4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80882835 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(Sc2nc3ccc(C)cc3[nH]2)n1 |
| InChI | InChI=1S/C15H17N5S/c1-3-7-16-14-17-8-6-13(20-14)21-15-18-11-5-4-10(2)9-12(11)19-15/h4-6,8-9H,3,7H2,1-2H3,(H,18,19)(H,16,17,20) |
| InChIKey | OKVXOEVCYZGPRQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |