C12H15N5O3S — CID 80883777
4-methyl-3-[3-nitro-5-(propylamino)phenyl]sulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 80883777) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-methyl-3-[3-nitro-5-(propylamino)phenyl]sulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-methyl-3-[3-nitro-5-(propylamino)phenyl]sulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80883777 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-methyl-3-[3-nitro-5-(propylamino)phenyl]sulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCNc1cc(Sc2n[nH]c(=O)n2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N5O3S/c1-3-4-13-8-5-9(17(19)20)7-10(6-8)21-12-15-14-11(18)16(12)2/h5-7,13H,3-4H2,1-2H3,(H,14,18) |
| InChIKey | APXLTIOCCZQVKM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|