C9H15N3OS — CID 80884568
2-[5-ethyl-6-(methylamino)pyrimidin-4-yl]sulfanylethanol (PubChem CID 80884568) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-[5-ethyl-6-(methylamino)pyrimidin-4-yl]sulfanylethanol.
| Compound Name | 2-[5-ethyl-6-(methylamino)pyrimidin-4-yl]sulfanylethanol |
|---|---|
| PubChem CID | 80884568 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[5-ethyl-6-(methylamino)pyrimidin-4-yl]sulfanylethanol |
| SMILES | CCc1c(NC)ncnc1SCCO |
| InChI | InChI=1S/C9H15N3OS/c1-3-7-8(10-2)11-6-12-9(7)14-5-4-13/h6,13H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | BABAHZFTIHQGKD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |