C11H20N4S — CID 80894668
6-[2-(dimethylamino)ethylsulfanyl]-5-ethyl-N-methylpyrimidin-4-amine (PubChem CID 80894668) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylsulfanyl]-5-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-[2-(dimethylamino)ethylsulfanyl]-5-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80894668 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-[2-(dimethylamino)ethylsulfanyl]-5-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1c(NC)ncnc1SCCN(C)C |
| InChI | InChI=1S/C11H20N4S/c1-5-9-10(12-2)13-8-14-11(9)16-7-6-15(3)4/h8H,5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | AYBCWSJORISVCM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |