C13H14N6S — CID 80885003
N-propyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazolin-2-amine (PubChem CID 80885003) has the molecular formula C13H14N6S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-propyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazolin-2-amine.
| Compound Name | N-propyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 80885003 |
| Molecular Formula | C13H14N6S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-propyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazolin-2-amine |
| SMILES | CCCNc1nc(Sc2ncn[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C13H14N6S/c1-2-7-14-12-17-10-6-4-3-5-9(10)11(18-12)20-13-15-8-16-19-13/h3-6,8H,2,7H2,1H3,(H,14,17,18)(H,15,16,19) |
| InChIKey | OKVLNQIHQKTFFB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |