C9H15N3S — CID 80887950
2,5-dimethyl-6-propylsulfanylpyrimidin-4-amine (PubChem CID 80887950) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 2,5-dimethyl-6-propylsulfanylpyrimidin-4-amine.
| Compound Name | 2,5-dimethyl-6-propylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80887950 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,5-dimethyl-6-propylsulfanylpyrimidin-4-amine |
| SMILES | CCCSc1nc(C)nc(N)c1C |
| InChI | InChI=1S/C9H15N3S/c1-4-5-13-9-6(2)8(10)11-7(3)12-9/h4-5H2,1-3H3,(H2,10,11,12) |
| InChIKey | BHDLKGREOQSBKA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |