C8H13N3S — CID 80888720
4-ethylsulfanyl-N,6-dimethylpyrimidin-2-amine (PubChem CID 80888720) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 4-ethylsulfanyl-N,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-ethylsulfanyl-N,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80888720 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-ethylsulfanyl-N,6-dimethylpyrimidin-2-amine |
| SMILES | CCSc1cc(C)nc(NC)n1 |
| InChI | InChI=1S/C8H13N3S/c1-4-12-7-5-6(2)10-8(9-3)11-7/h5H,4H2,1-3H3,(H,9,10,11) |
| InChIKey | CXWJAGWVNIUWCQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |