C9H13N3OS2 — CID 80891476
N-methyl-2-methylsulfanyl-6-(oxetan-3-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80891476) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-6-(oxetan-3-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | N-methyl-2-methylsulfanyl-6-(oxetan-3-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80891476 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-methyl-2-methylsulfanyl-6-(oxetan-3-ylsulfanyl)pyrimidin-4-amine |
| SMILES | CNc1cc(SC2COC2)nc(SC)n1 |
| InChI | InChI=1S/C9H13N3OS2/c1-10-7-3-8(12-9(11-7)14-2)15-6-4-13-5-6/h3,6H,4-5H2,1-2H3,(H,10,11,12) |
| InChIKey | GYOVPVUTUQSIFK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |