C10H13N3OS — CID 114769687
2-methyl-6-(oxetan-3-ylsulfanyl)pyridine-4-carboximidamide (PubChem CID 114769687) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-methyl-6-(oxetan-3-ylsulfanyl)pyridine-4-carboximidamide.
| Compound Name | 2-methyl-6-(oxetan-3-ylsulfanyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769687 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-methyl-6-(oxetan-3-ylsulfanyl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(SC2COC2)c1 |
| InChI | InChI=1S/C10H13N3OS/c1-6-2-7(10(11)12)3-9(13-6)15-8-4-14-5-8/h2-3,8H,4-5H2,1H3,(H3,11,12) |
| InChIKey | INMQANMXSFKHCA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|