C11H9F2N3S — CID 80892854
4-(2,4-difluorophenyl)sulfanyl-N-methylpyrimidin-2-amine (PubChem CID 80892854) has the molecular formula C11H9F2N3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanyl-N-methylpyrimidin-2-amine.
| Compound Name | 4-(2,4-difluorophenyl)sulfanyl-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80892854 |
| Molecular Formula | C11H9F2N3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanyl-N-methylpyrimidin-2-amine |
| SMILES | CNc1nccc(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C11H9F2N3S/c1-14-11-15-5-4-10(16-11)17-9-3-2-7(12)6-8(9)13/h2-6H,1H3,(H,14,15,16) |
| InChIKey | IPTOUWCDQNLBKX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |