C11H6ClF2NS — CID 60726004
2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine (PubChem CID 60726004) has the molecular formula C11H6ClF2NS and a molecular weight of 257.69 g/mol. Its IUPAC name is 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine.
| Compound Name | 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine |
|---|---|
| PubChem CID | 60726004 |
| Molecular Formula | C11H6ClF2NS |
| Molecular Weight | 257.69 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine |
| SMILES | Fc1ccc(Sc2cccc(Cl)n2)c(F)c1 |
| InChI | InChI=1S/C11H6ClF2NS/c12-10-2-1-3-11(15-10)16-9-5-4-7(13)6-8(9)14/h1-6H |
| InChIKey | ACLHJZZFHPCLOT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|