C12H9F2N3S — CID 64593647
6-(2,4-difluorophenyl)sulfanylpyridine-2-carboximidamide (PubChem CID 64593647) has the molecular formula C12H9F2N3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfanylpyridine-2-carboximidamide.
| Compound Name | 6-(2,4-difluorophenyl)sulfanylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 64593647 |
| Molecular Formula | C12H9F2N3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfanylpyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H9F2N3S/c13-7-4-5-10(8(14)6-7)18-11-3-1-2-9(17-11)12(15)16/h1-6H,(H3,15,16) |
| InChIKey | ANICNCYDZAGEKO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|