C12H10F2N4S — CID 107551795
2-(2,4-difluorophenyl)sulfanyl-6-methylpyrimidine-4-carboximidamide (PubChem CID 107551795) has the molecular formula C12H10F2N4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107551795 |
| Molecular Formula | C12H10F2N4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H10F2N4S/c1-6-4-9(11(15)16)18-12(17-6)19-10-3-2-7(13)5-8(10)14/h2-5H,1H3,(H3,15,16) |
| InChIKey | AGUKWSVBVYLGIE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|