C11H6F2N2O2S — CID 60792591
6-(2,4-difluorophenyl)sulfanylpyridazine-3-carboxylic acid (PubChem CID 60792591) has the molecular formula C11H6F2N2O2S and a molecular weight of 268.24 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfanylpyridazine-3-carboxylic acid.
| Compound Name | 6-(2,4-difluorophenyl)sulfanylpyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 60792591 |
| Molecular Formula | C11H6F2N2O2S |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfanylpyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Sc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C11H6F2N2O2S/c12-6-1-3-9(7(13)5-6)18-10-4-2-8(11(16)17)14-15-10/h1-5H,(H,16,17) |
| InChIKey | DZGMWKDQGFBZPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |