C10H15N7OS — CID 80896902
4-ethoxy-6-hydrazinyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazin-2-amine (PubChem CID 80896902) has the molecular formula C10H15N7OS and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-ethoxy-6-hydrazinyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-hydrazinyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80896902 |
| Molecular Formula | C10H15N7OS |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-ethoxy-6-hydrazinyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NN)nc(NCc2csc(C)n2)n1 |
| InChI | InChI=1S/C10H15N7OS/c1-3-18-10-15-8(14-9(16-10)17-11)12-4-7-5-19-6(2)13-7/h5H,3-4,11H2,1-2H3,(H2,12,14,15,16,17) |
| InChIKey | JZWJLZMATBOHKV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|